On Target OPRK_HUMAN 0.4071856/CHEMBL192998
For the given ligand Glimepiride, we have found in our database that, being scored 0.4071856, the most similar ligand is CHEMBL192998. Check out the elaboration below.
| Glimepiride (Given Ligand) | CHEMBL192998 (Similar Ligand) |
|---|---|
| CC/C3=C(C)/CN(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)N[C@@H]1CC[C@@H](C)CC1)cc2)C3=O | CN([C@H](CN1CC[C@H](O)C1)c2ccccc2)C(=O)Cc3ccc(CNS(=O)(=O)c4ccc(C)cc4)cc3 |
|
|
|
|
|
|
| 00000010 01809000 01100100 02b10e00 00000048 08000000 08000004 20003404 01000000 011828c0 08202000 e0019400 04009102 00010041 80200000 00000000 22002008 02000500 02412040 00006201 80022100 18250710 00008000 89500018 00010000 88000000 80400000 1000052c 04000400 20060003 0c0a0000 00012660 | 00000010 00803000 01180100 05b10600 00080088 00000010 04000001 22001008 00000180 000818c0 08302000 60009800 81008802 00002001 c0380400 00080008 10002000 02100000 00c00000 00006201 80000000 38208600 03000081 8b400018 02000001 c0000004 40000000 9000002c 0c000500 20060003 20042000 00012760 |