On Target ALDR_HUMAN 0.0546875/CHEMBL293869
For the given ligand Metformin, we have found in our database that, being scored 0.0546875, the most similar ligand is CHEMBL293869. Check out the elaboration below.
| Metformin (Given Ligand) | CHEMBL293869 (Similar Ligand) |
|---|---|
| CN(C)C(=N)NC(=N)N | CN1C(=O)Nc2ccccc2[C@@]13NC(=O)NC3=O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 00000000 00000000 00000000 00002000 00000000 00000002 00200000 00000002 00000000 00000000 00000000 00200000 00000000 00000000 00000000 00000000 00000100 00020000 00000000 00000000 00000000 00000000 40000000 20000000 00000010 00040000 00000001 00000000 | 00010006 03803000 00100100 00010e00 00000000 40100002 00000004 0200300d 00000000 000a0840 0d280066 4000b000 0500b800 00102000 40020140 00000000 0004c018 03402024 08000010 008000c1 c0020500 38238600 20022000 81400018 00101000 80000200 00000010 80001080 0c009100 00060a03 20046001 e0004600 |