On Target ALDR_HUMAN 0.27807486/CHEMBL71562
For the given ligand Canagliflozin, we have found in our database that, being scored 0.27807486, the most similar ligand is CHEMBL71562. Check out the elaboration below.
| Canagliflozin (Given Ligand) | CHEMBL71562 (Similar Ligand) |
|---|---|
| Cc2ccc([C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)cc2Cc4ccc(c3ccc(F)cc3)s4 | CCC[C@@H]1C[C@@](O)(CC(=O)O)c2cc(F)ccc2O1 |
|
|
|
|
|
|
| 00012000 01800000 80100102 02050300 80a80051 10024010 00040480 0d102009 00000900 01480841 28100200 c0008a80 00000010 02a11000 00042000 020a9008 08020800 0200400a 15502000 50100005 00000920 680900a0 35004040 08400010 02000400 a4002000 00080800 40800265 020043ca 00068002 40020004 02c30600 | 04010000 01000018 2010010a 02010300 00081000 82004010 06000000 00000a00 00000900 01082840 08100000 50009040 1680802a 02a01000 11000001 00082008 00800000 22008000 01402008 00420001 00000100 08000a20 01001040 02400410 00000800 c0000002 80000000 00000001 00100302 0003c002 40024000 00000600 |