On Target AOFB_HUMAN 0.284153/CHEMBL600391
For the given ligand Canagliflozin, we have found in our database that, being scored 0.284153, the most similar ligand is CHEMBL600391. Check out the elaboration below.
| Canagliflozin (Given Ligand) | CHEMBL600391 (Similar Ligand) |
|---|---|
| Cc2ccc([C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)cc2Cc4ccc(c3ccc(F)cc3)s4 | Cc1ccc(cc1)C2CC(=O)c3ccc(F)cc3O2 |
|
|
|
|
|
|
| 00012000 01800000 80100102 02050300 80a80051 10024010 00040480 0d102009 00000900 01480841 28100200 c0008a80 00000010 02a11000 00042000 020a9008 08020800 0200400a 15502000 50100005 00000920 680900a0 35004040 08400010 02000400 a4002000 00080800 40800265 020043ca 00068002 40020004 02c30600 | 04000000 01000818 2010010a 02050300 00001000 82224010 02000000 00000200 00000900 00088840 08100000 40009860 14808002 00211000 11200001 020a2008 00000000 02008080 00400008 00120009 00000100 08020220 01000060 00c01014 00004800 c0002000 00000800 00000001 00000300 0002c002 c0000010 00000600 |