On Target ACM1_HUMAN 0.38265306/CHEMBL343659
For the given ligand Sitagliptin, we have found in our database that, being scored 0.38265306, the most similar ligand is CHEMBL343659. Check out the elaboration below.
| Sitagliptin (Given Ligand) | CHEMBL343659 (Similar Ligand) |
|---|---|
| N[C@@H](CC(=O)N1CCn2c(C1)nnc2C(F)(F)F)Cc3cc(F)c(F)cc3F | Cc1cccc(CN2CCC(CC2)NC(=O)C(O)(C3CCCC3)c4ccccc4)n1 |
|
|
|
|
|
|
| 00010040 01002408 40102102 02010e00 01100600 00100016 08800800 28002401 00100900 001929e0 08310120 d4019800 0c009006 04201000 00020800 0008200c 0100d200 020000a2 00400000 00b61a01 00000103 38232600 21000001 83500418 00010010 c0000400 c0400000 90021001 0c344004 00068013 84200080 00400e00 | 00010002 01001400 00104102 10010e00 000c00a1 00104002 00000000 22003001 00000980 000809e0 08310004 5001d000 0500880a 00a00000 400a0400 020c010c 10000000 02000022 00602000 00000201 40000100 18298630 23800000 81500018 00100000 c0000000 00000040 90001000 04000106 01060013 60062000 00006600 |