On Target PGH1_SHEEP 0.35465115/CHEMBL3775653
For the given ligand Glipizide, we have found in our database that, being scored 0.35465115, the most similar ligand is CHEMBL3775653. Check out the elaboration below.
| Glipizide (Given Ligand) | CHEMBL3775653 (Similar Ligand) |
|---|---|
| Cc3cnc(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)NC1CCCCC1)cc2)cn3 | CCCCCCNC(=O)Nc1cccc(c1)c2ccc(cc2F)C(C)C(=O)O |
|
|
|
|
|
|
| 10000012 01801000 01100900 12b10e10 04000048 00100000 0800c000 00003005 10000080 000828d0 09292000 e0018400 00009002 08100041 80a20480 00040104 0a022000 02000002 02402000 00006201 80002000 18258e10 21004000 89500118 00140000 80000000 88000000 9000042c 04000404 20060803 a0080000 80010660 | 00002006 01001000 00100100 02010e00 04000040 00000010 00000004 00002001 00000100 000828d0 08280004 50019800 01009000 08101000 40040040 00080008 08060200 02400000 0c002000 10000001 40000100 18050e10 31022000 00500018 00150004 80080000 80000200 100000c1 0040c000 00068003 00082000 00004600 |