On Target CNR1_HUMAN 0.52409637/CHEMBL375960
For the given ligand Glipizide, we have found in our database that, being scored 0.52409637, the most similar ligand is CHEMBL375960. Check out the elaboration below.
| Glipizide (Given Ligand) | CHEMBL375960 (Similar Ligand) |
|---|---|
| Cc3cnc(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)NC1CCCCC1)cc2)cn3 | Cc1ccc(cc1)c2ncc(nc2c3ccc(C)cc3)C(=O)NC4CCCCC4 |
|
|
|
|
|
|
| 10000012 01801000 01100900 12b10e10 04000048 00100000 0800c000 00003005 10000080 000828d0 09292000 e0018400 00009002 08100041 80a20480 00040104 0a022000 02000002 02402000 00006201 80002000 18258e10 21004000 89500118 00140000 80000000 88000000 9000042c 04000404 20060803 a0080000 80010660 | 10000002 01801001 00100900 10010e10 04000040 0410000a 1040c000 20083041 10000100 100008d0 01298080 40018000 00008002 08300000 20820480 80040104 08020000 02002022 06002000 10400201 81000000 38058e10 21004000 00500118 00140001 80080000 08000210 90001044 00004004 01260801 a0000820 80000200 |