On Target NMDE2_HUMAN 0.37096775/CHEMBL1779012
For the given ligand Glipizide, we have found in our database that, being scored 0.37096775, the most similar ligand is CHEMBL1779012. Check out the elaboration below.
| Glipizide (Given Ligand) | CHEMBL1779012 (Similar Ligand) |
|---|---|
| Cc3cnc(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)NC1CCCCC1)cc2)cn3 | COc1cc(F)ccc1c2cncc(CNC(=O)c3cnccn3)c2 |
|
|
|
|
|
|
| 10000012 01801000 01100900 12b10e10 04000048 00100000 0800c000 00003005 10000080 000828d0 09292000 e0018400 00009002 08100041 80a20480 00040104 0a022000 02000002 02402000 00006201 80002000 18258e10 21004000 89500118 00140000 80000000 88000000 9000042c 04000404 20060803 a0080000 80010660 | 10002002 01808008 20104908 12010e10 00841040 04100018 1200c000 02003001 10000000 00008840 01290004 40008000 00408802 00101000 01820401 8004210c 08022000 06001006 04200000 00120002 c0000000 08008e00 31804000 0040c008 00140001 c0080000 18000200 80000045 00404304 10068801 80000218 80000200 |