On Target P2RX3_HUMAN 0.35267857/CHEMBL3674821
For the given ligand Canagliflozin, we have found in our database that, being scored 0.35267857, the most similar ligand is CHEMBL3674821. Check out the elaboration below.
| Canagliflozin (Given Ligand) | CHEMBL3674821 (Similar Ligand) |
|---|---|
| Cc2ccc([C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)cc2Cc4ccc(c3ccc(F)cc3)s4 | COCc1ccccc1C2C(C(=O)CC(C)C)C(=O)C(=O)N2c3ccc(cc3)c4ccc(C)s4 |
|
|
|
|
|
|
| 00012000 01800000 80100102 02050300 80a80051 10024010 00040480 0d102009 00000900 01480841 28100200 c0008a80 00000010 02a11000 00042000 020a9008 08020800 0200400a 15502000 50100005 00000920 680900a0 35004040 08400010 02000400 a4002000 00080800 40800265 020043ca 00068002 40020004 02c30600 | 0003e002 01801800 02100102 10010600 20000000 00026410 01040080 2e101008 04100900 000808c1 08380204 5001fa80 0e00881a 00318000 800224e0 02080008 00060000 02004009 0c002018 10000201 c0120500 580686b0 30016000 00500018 02001800 c4002681 00004000 900002c4 0000c31b 00060003 60065020 00c10600 |