On Target 5HT2A_HUMAN 0.45751634/CHEMBL179993
For the given ligand Glipizide, we have found in our database that, being scored 0.45751634, the most similar ligand is CHEMBL179993. Check out the elaboration below.
| Glipizide (Given Ligand) | CHEMBL179993 (Similar Ligand) |
|---|---|
| Cc3cnc(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)NC1CCCCC1)cc2)cn3 | CCN(C1CCN(CCC(c2ccccc2)c3ccccc3)CC1)C(=O)Cc4ccc(cc4)S(=O)(=O)N(C)C |
|
|
|
|
|
|
| 10000012 01801000 01100900 12b10e10 04000048 00100000 0800c000 00003005 10000080 000828d0 09292000 e0018400 00009002 08100041 80a20480 00040104 0a022000 02000002 02402000 00006201 80002000 18258e10 21004000 89500118 00140000 80000000 88000000 9000042c 04000404 20060803 a0080000 80010660 | 00000010 01801600 01100100 00b10600 00000008 00000000 00000000 21000000 00000880 000809e0 08302000 70019000 01008002 00000001 c0200000 00040000 00002000 02000000 00400000 00006201 80000100 182c0600 00000000 89500018 00000000 a0000000 00000000 5000002c 04000480 2006001b 00002000 00012660 |