On Target AGTR2_HUMAN 0.37222221/CHEMBL214525
For the given ligand Glimepiride, we have found in our database that, being scored 0.37222221, the most similar ligand is CHEMBL214525. Check out the elaboration below.
| Glimepiride (Given Ligand) | CHEMBL214525 (Similar Ligand) |
|---|---|
| CC/C3=C(C)/CN(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)N[C@@H]1CC[C@@H](C)CC1)cc2)C3=O | CCCCc1ccc(c(c1)c2ccc(Cn3ccnc3)cc2)S(=O)(=O)NC(=O)OCC |
|
|
|
|
|
|
| 00000010 01809000 01100100 02b10e00 00000048 08000000 08000004 20003404 01000000 011828c0 08202000 e0019400 04009102 00010041 80200000 00000000 22002008 02000500 02412040 00006201 80022100 18250710 00008000 89500018 00010000 88000000 80400000 1000052c 04000400 20060003 0c0a0000 00012660 | 00002012 01c01201 01000102 04b10600 00080049 00000020 00000000 00001000 00000908 000828c0 0810a009 60008000 80089808 00210001 88300080 001c000c 02022080 02001000 04400000 10006001 80000100 18048c00 31200040 89480018 0000a004 80000082 80080000 0000006f 04004600 2046004a 400c5000 00010660 |