On Target AGTR2_HUMAN 0.35/CHEMBL3144487
For the given ligand Sitagliptin, we have found in our database that, being scored 0.35, the most similar ligand is CHEMBL3144487. Check out the elaboration below.
| Sitagliptin (Given Ligand) | CHEMBL3144487 (Similar Ligand) |
|---|---|
| N[C@@H](CC(=O)N1CCn2c(C1)nnc2C(F)(F)F)Cc3cc(F)c(F)cc3F | CC[C@H](C)[C@H](NC(=O)[C@@H](NC[C@@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](N)CC(=O)O)C(C)C)c1ccc(O)cc1)C(=O)N[C@@H](Cc2c[nH]cn2)C(=O)N3CCC[C@H]3C(=O)N[C@@H](Cc4ccccc4)C(=O)N[C@@H](Cc5c[nH]cn5)C(=O)C(N)[C@H](CC(C)C)C(=O)C |
|
|
|
|
|
|
| 00010040 01002408 40102102 02010e00 01100600 00100016 08800800 28002401 00100900 001929e0 08310120 d4019800 0c009006 04201000 00020800 0008200c 0100d200 020000a2 00400000 00b61a01 00000103 38232600 21000001 83500418 00010010 c0000400 c0400000 90021001 0c344004 00068013 84200080 00400e00 | 04070002 01003608 20100102 05810e10 04100340 00000010 03002020 2200300c 00700b80 00090bc2 28308000 5003b800 0f00981a 00102801 c1020400 001c000c 00000000 0e000000 00c02018 40020201 20300d00 382d8e30 21000003 93500018 00041800 c0000200 40320000 90000180 0c000116 0046001b e00e6000 20802e00 |