On Target AGTR2_HUMAN 0.44298247/CHEMBL304620
For the given ligand Glipizide, we have found in our database that, being scored 0.44298247, the most similar ligand is CHEMBL304620. Check out the elaboration below.
| Glipizide (Given Ligand) | CHEMBL304620 (Similar Ligand) |
|---|---|
| Cc3cnc(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)NC1CCCCC1)cc2)cn3 | CCCCN(Cc1nc(CCC)n(Cc2ccc(cc2)c3ccccc3S(=O)(=O)NC(=O)CCC)c1C(=O)O)C(=O)CCC |
|
|
|
|
|
|
| 10000012 01801000 01100900 12b10e10 04000048 00100000 0800c000 00003005 10000080 000828d0 09292000 e0018400 00009002 08100041 80a20480 00040104 0a022000 02000002 02402000 00006201 80002000 18258e10 21004000 89500118 00140000 80000000 88000000 9000042c 04000404 20060803 a0080000 80010660 | 1000201a 01801201 01101500 11b10e10 00080040 0010800a 00004080 28003005 80400308 504438d0 4029a028 62009800 840898a2 00300001 80730480 080c000c 0202a080 87000022 84480008 50016e41 80020000 18058e80 31000040 9940051c 02042004 c1000484 80004010 9000104c 04004405 20c60849 e00c5084 a001a678 |