On Target OPRM_MOUSE 0.38011697/CHEMBL2017153
For the given ligand Glimepiride, we have found in our database that, being scored 0.38011697, the most similar ligand is CHEMBL2017153. Check out the elaboration below.
| Glimepiride (Given Ligand) | CHEMBL2017153 (Similar Ligand) |
|---|---|
| CC/C3=C(C)/CN(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)N[C@@H]1CC[C@@H](C)CC1)cc2)C3=O | Oc1ccc2CC34CN(CC5CC5)CCC3(CC=C(C4)C(=O)NCCc6ccccc6)c2c1 |
|
|
|
|
|
|
| 00000010 01809000 01100100 02b10e00 00000048 08000000 08000004 20003404 01000000 011828c0 08202000 e0019400 04009102 00010041 80200000 00000000 22002008 02000500 02412040 00006201 80022100 18250710 00008000 89500018 00010000 88000000 80400000 1000052c 04000400 20060003 0c0a0000 00012660 | 00010010 43009208 20100102 00110600 00000000 40000002 02100080 20000407 11000880 001808c2 08300000 50019000 0402811a 01211000 00000420 02060108 20004000 02000120 00012000 00020201 00000100 182006b0 0000c000 81540018 00200000 80002001 005a4000 90000000 04000002 0006000b 24020000 02012600 |