On Target P2Y12_HUMAN 0.27054796/CHEMBL3098234
For the given ligand Canagliflozin, we have found in our database that, being scored 0.27054796, the most similar ligand is CHEMBL3098234. Check out the elaboration below.
| Canagliflozin (Given Ligand) | CHEMBL3098234 (Similar Ligand) |
|---|---|
| Cc2ccc([C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)cc2Cc4ccc(c3ccc(F)cc3)s4 | CCCSc1nc(N[C@@H]2C[C@H]2c3ccc(Cl)s3)c4nnn([C@@H]5C[C@H](OCCO)[C@@H](O)[C@H]5O)c4n1 |
|
|
|
|
|
|
| 00012000 01800000 80100102 02050300 80a80051 10024010 00040480 0d102009 00000900 01480841 28100200 c0008a80 00000010 02a11000 00042000 020a9008 08020800 0200400a 15502000 50100005 00000920 680900a0 35004040 08400010 02000400 a4002000 00080800 40800265 020043ca 00068002 40020004 02c30600 | 0001c00b a3000b18 e01001a0 08192720 20388060 c000e014 04008180 10102902 00020900 11c84080 0130020c c0219980 06053035 838c0100 72422281 100ed00c 04a40080 06014008 99c00020 00262045 80120920 583c01d1 27805044 8dc80015 06202c02 16000204 10040208 100052b4 0e000208 0146000a d8001000 0de386d0 |