On Target P2Y12_HUMAN 0.35114503/CHEMBL2172144
For the given ligand Sitagliptin, we have found in our database that, being scored 0.35114503, the most similar ligand is CHEMBL2172144. Check out the elaboration below.
| Sitagliptin (Given Ligand) | CHEMBL2172144 (Similar Ligand) |
|---|---|
| N[C@@H](CC(=O)N1CCn2c(C1)nnc2C(F)(F)F)Cc3cc(F)c(F)cc3F | OC(=O)CC[C@H](NC(=O)c1cc(OCC(=O)N2CCC[C@H]2C(=O)NC3CCC3)n(n1)c4ccccc4)C(=O)N5CCC(CC5)C(=O)c6ccccc6 |
|
|
|
|
|
|
| 00010040 01002408 40102102 02010e00 01100600 00100016 08800800 28002401 00100900 001929e0 08310120 d4019800 0c009006 04201000 00020800 0008200c 0100d200 020000a2 00400000 00b61a01 00000103 38232600 21000001 83500418 00010010 c0000400 c0400000 90021001 0c344004 00068013 84200080 00400e00 | 0403a006 45003a18 6018010a 04210e06 21188080 00004016 00000000 20283408 00100b04 401b08c0 093d0024 5011f000 0600c832 01202292 81985440 221c202c 10000000 82800808 80480000 00a60201 40040100 38078e20 33800801 8354801c 00204c00 c0000040 40220018 90000801 0c000304 0046000b e50ec000 82c02fa0 |