On Target NOS2_HUMAN 0.31333333/CHEMBL490886
For the given ligand Glimepiride, we have found in our database that, being scored 0.31333333, the most similar ligand is CHEMBL490886. Check out the elaboration below.
| Glimepiride (Given Ligand) | CHEMBL490886 (Similar Ligand) |
|---|---|
| CC/C3=C(C)/CN(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)N[C@@H]1CC[C@@H](C)CC1)cc2)C3=O | Cl.CC(=N)NCc1cccc(CNS(=O)(=O)c2ccc(C)cc2)c1 |
|
|
|
|
|
|
| 00000010 01809000 01100100 02b10e00 00000048 08000000 08000004 20003404 01000000 011828c0 08202000 e0019400 04009102 00010041 80200000 00000000 22002008 02000500 02412040 00006201 80022100 18250710 00008000 89500018 00010000 88000000 80400000 1000052c 04000400 20060003 0c0a0000 00012660 | 00000010 00801000 01080100 01b10600 00080009 00000000 14000001 02001000 00000000 00001853 00302000 60008000 00000802 00000001 80200400 00100008 00002000 02100000 00400800 00006000 80000000 08008000 00000000 08400008 02000000 c0000004 48000000 9000002c 00000510 20060000 00040000 00030360 |