On Target NOS2_HUMAN 0.25247526/CHEMBL8105
For the given ligand Canagliflozin, we have found in our database that, being scored 0.25247526, the most similar ligand is CHEMBL8105. Check out the elaboration below.
| Canagliflozin (Given Ligand) | CHEMBL8105 (Similar Ligand) |
|---|---|
| Cc2ccc([C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)cc2Cc4ccc(c3ccc(F)cc3)s4 | NC1=NC(Cc2sccc12)C3CC3 |
|
|
|
|
|
|
| 00012000 01800000 80100102 02050300 80a80051 10024010 00040480 0d102009 00000900 01480841 28100200 c0008a80 00000010 02a11000 00042000 020a9008 08020800 0200400a 15502000 50100005 00000920 680900a0 35004040 08400010 02000400 a4002000 00080800 40800265 020043ca 00068002 40020004 02c30600 | 00010008 41040000 00200902 1c000600 40100022 00000000 120900a0 00001000 00000800 00480083 00300230 c0000280 00002019 01202009 00243020 00084004 08000800 0200000a 00002000 00009005 00000900 7a088080 00104100 83400012 02008030 04000001 40010000 00000104 0c20000a 01860002 18000000 00c10410 |