On Target PRGR_HUMAN 0.365/CHEMBL1085381
For the given ligand Glipizide, we have found in our database that, being scored 0.365, the most similar ligand is CHEMBL1085381. Check out the elaboration below.
| Glipizide (Given Ligand) | CHEMBL1085381 (Similar Ligand) |
|---|---|
| Cc3cnc(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)NC1CCCCC1)cc2)cn3 | CC(C)CNS(=O)(=O)c1ccc(c2ccc3c(cnn3c4ccc(F)cc4)c2)c(c1)C(F)(F)F |
|
|
|
|
|
|
| 10000012 01801000 01100900 12b10e10 04000048 00100000 0800c000 00003005 10000080 000828d0 09292000 e0018400 00009002 08100041 80a20480 00040104 0a022000 02000002 02402000 00006201 80002000 18258e10 21004000 89500118 00140000 80000000 88000000 9000042c 04000404 20060803 a0080000 80010660 | 00002016 00801609 21100100 03b10600 000c0108 10014010 02000400 00001004 04100100 004108d0 01002004 60018000 00000802 01601001 a02000c0 000c010c 00022000 02000004 04600000 00226602 c4000000 1c018038 30801800 9b600038 02100000 80000404 00000000 9000106d 04004400 20468048 40140000 800146e0 |