On Target DRD4_HUMAN 0.35099337/CHEMBL3590080
For the given ligand Glimepiride, we have found in our database that, being scored 0.35099337, the most similar ligand is CHEMBL3590080. Check out the elaboration below.
| Glimepiride (Given Ligand) | CHEMBL3590080 (Similar Ligand) |
|---|---|
| CC/C3=C(C)/CN(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)N[C@@H]1CC[C@@H](C)CC1)cc2)C3=O | CCCN(CCCCNC(=O)\C=C\c1ccc(F)cc1)C2Cc3ccccc3C2 |
|
|
|
|
|
|
| 00000010 01809000 01100100 02b10e00 00000048 08000000 08000004 20003404 01000000 011828c0 08202000 e0019400 04009102 00010041 80200000 00000000 22002008 02000500 02412040 00006201 80022100 18250710 00008000 89500018 00010000 88000000 80400000 1000052c 04000400 20060003 0c0a0000 00012660 | 00000000 01009000 00100102 02010600 00000020 00000010 80100080 20000400 01a00880 004808c0 08300000 40028000 00008002 00211000 00080002 00020000 20000600 02000100 00018000 00900201 00000100 18240600 00004000 81400018 00000000 80000000 00482000 50010001 04400000 00068003 04000000 02002600 |