On Target DRD4_HUMAN 0.078947365/CHEMBL327310
For the given ligand Metformin, we have found in our database that, being scored 0.078947365, the most similar ligand is CHEMBL327310. Check out the elaboration below.
| Metformin (Given Ligand) | CHEMBL327310 (Similar Ligand) |
|---|---|
| CN(C)C(=N)NC(=N)N | O=C(NC1CCN(Cc2ccccc2)CC1)NC(=O)c3ccccc3 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 00000000 00000000 00000000 00002000 00000000 00000002 00200000 00000002 00000000 00000000 00000000 00200000 00000000 00000000 00000000 00000000 00000100 00020000 00000000 00000000 00000000 00000000 40000000 20000000 00000010 00040000 00000001 00000000 | 00000000 01801c00 00100100 00010e00 00000000 00000000 00000004 22003000 00000000 000009e0 01200000 50018000 00009802 00000000 00000400 00000000 00004000 02000000 00000040 00000201 80020100 180b8600 00000000 0050001c 00010000 c0000000 00000000 90000000 00000100 00060011 a0140000 80000200 |