On Target PGH2_HUMAN 0.5362319/CHEMBL3233599
For the given ligand Glimepiride, we have found in our database that, being scored 0.5362319, the most similar ligand is CHEMBL3233599. Check out the elaboration below.
| Glimepiride (Given Ligand) | CHEMBL3233599 (Similar Ligand) |
|---|---|
| CC/C3=C(C)/CN(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)N[C@@H]1CC[C@@H](C)CC1)cc2)C3=O | CN1C(=O)C(=C(C1=O)c2ccc(cc2)S(=O)(=O)N)c3ccccc3 |
|
|
|
|
|
|
| 00000010 01809000 01100100 02b10e00 00000048 08000000 08000004 20003404 01000000 011828c0 08202000 e0019400 04009102 00010041 80200000 00000000 22002008 02000500 02412040 00006201 80022100 18250710 00008000 89500018 00010000 88000000 80400000 1000052c 04000400 20060003 0c0a0000 00012660 | 00000010 00809000 01100100 00b10600 00000008 08000000 80000080 00000404 01800080 00480840 08202100 60009000 01008002 00010001 c0200002 00000000 20000400 02000100 40218000 00802200 80020000 18240700 00000000 89400018 00000000 88000000 00402000 40010128 04400000 20060003 0c002000 00012620 |