On Target 5HT1B_HUMAN 0.3957219/CHEMBL332484
For the given ligand Glimepiride, we have found in our database that, being scored 0.3957219, the most similar ligand is CHEMBL332484. Check out the elaboration below.
| Glimepiride (Given Ligand) | CHEMBL332484 (Similar Ligand) |
|---|---|
| CC/C3=C(C)/CN(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)N[C@@H]1CC[C@@H](C)CC1)cc2)C3=O | CN1CCC[C@@H]1Cc2c[nH]c3ccc(cc23)C4=CCN(CC4)C(=O)NC56C[C@@H]7C[C@@H](C[C@@H](C7)C5)C6 |
|
|
|
|
|
|
| 00000010 01809000 01100100 02b10e00 00000048 08000000 08000004 20003404 01000000 011828c0 08202000 e0019400 04009102 00010041 80200000 00000000 22002008 02000500 02412040 00006201 80022100 18250710 00008000 89500018 00010000 88000000 80400000 1000052c 04000400 20060003 0c0a0000 00012660 | 00000012 0900da00 00100102 41810e10 00041140 00000010 80182084 20002400 00400980 015908c0 08300004 40018800 18009902 00610800 00000042 00040004 20000400 02000544 42202442 00800201 41000100 18258418 20808000 91500018 00052000 80000000 08482040 d0010100 04400002 0006040b 2c0e0200 00002620 |