On Target CXCR4_HUMAN 0.24680851/CHEMBL1644085
For the given ligand Canagliflozin, we have found in our database that, being scored 0.24680851, the most similar ligand is CHEMBL1644085. Check out the elaboration below.
| Canagliflozin (Given Ligand) | CHEMBL1644085 (Similar Ligand) |
|---|---|
| Cc2ccc([C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)cc2Cc4ccc(c3ccc(F)cc3)s4 | NCc1sccc1CN(Cc2nc3ccccc3[nH]2)C4CCCc5cccnc45 |
|
|
|
|
|
|
| 00012000 01800000 80100102 02050300 80a80051 10024010 00040480 0d102009 00000900 01480841 28100200 c0008a80 00000010 02a11000 00042000 020a9008 08020800 0200400a 15502000 50100005 00000920 680900a0 35004040 08400010 02000400 a4002000 00080800 40800265 020043ca 00068002 40020004 02c30600 | 0001001a 01004000 02104906 10800e10 00141162 00104000 01002080 22003003 00500900 000808c0 09318204 40818080 0000089a 00600821 00023440 020c0104 00002201 0600000e 00202408 00008209 40121100 580190a0 21804100 00500010 02148000 c4000001 08014040 90000084 00400106 00c60802 60040000 20c14681 |