On Target CNR2_HUMAN 0.094339624/CHEMBL1422818
For the given ligand Metformin, we have found in our database that, being scored 0.094339624, the most similar ligand is CHEMBL1422818. Check out the elaboration below.
| Metformin (Given Ligand) | CHEMBL1422818 (Similar Ligand) |
|---|---|
| CN(C)C(=N)NC(=N)N | O=C(NC(=S)N1CCCCC1)C23CC4CC(CC(C4)C2)C3 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 00000000 00000000 00000000 00002000 00000000 00000002 00200000 00000002 00000000 00000000 00000000 00200000 00000000 00000000 00000000 00000000 00000100 00020000 00000000 00000000 00000000 00000000 40000000 20000000 00000010 00040000 00000001 00000000 | 00010000 01000000 00100000 00000c00 00000000 00000000 00000004 20002000 00000400 00000080 00200000 50011000 0400900a 00000000 00000000 00000000 00010000 00000000 02002040 00000201 00000100 10010610 00000000 00100010 00010008 00000000 00000000 10000000 00200000 00040001 000a0000 00010208 |