On Target CNR2_HUMAN 0.37341774/CHEMBL3923170
For the given ligand Canagliflozin, we have found in our database that, being scored 0.37341774, the most similar ligand is CHEMBL3923170. Check out the elaboration below.
| Canagliflozin (Given Ligand) | CHEMBL3923170 (Similar Ligand) |
|---|---|
| Cc2ccc([C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)cc2Cc4ccc(c3ccc(F)cc3)s4 | Cc1cccc(c1)c2c(O)cc(cc2O)C(C)(C)c3cccs3 |
|
|
|
|
|
|
| 00012000 01800000 80100102 02050300 80a80051 10024010 00040480 0d102009 00000900 01480841 28100200 c0008a80 00000010 02a11000 00042000 020a9008 08020800 0200400a 15502000 50100005 00000920 680900a0 35004040 08400010 02000400 a4002000 00080800 40800265 020043ca 00068002 40020004 02c30600 | 00012001 42000008 20000100 00010200 00000001 00000000 02000080 01002001 00000100 00480840 08000200 c0008880 00400012 00000000 00002000 00002008 00020800 0200100a 04100000 10020a04 00000800 480c0080 10000000 00424010 02000000 a4000000 10000000 40000045 00004180 00020002 00000200 00c10400 |