On Target NTRK1_HUMAN 0.4155251/CHEMBL4113000
For the given ligand Glipizide, we have found in our database that, being scored 0.4155251, the most similar ligand is CHEMBL4113000. Check out the elaboration below.
| Glipizide (Given Ligand) | CHEMBL4113000 (Similar Ligand) |
|---|---|
| Cc3cnc(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)NC1CCCCC1)cc2)cn3 | Cc1cnc(cn1)C(=O)Nc2cnn3ccc(nc23)N4CCC[C@@H]4c5cccc(F)c5 |
|
|
|
|
|
|
| 10000012 01801000 01100900 12b10e10 04000048 00100000 0800c000 00003005 10000080 000828d0 09292000 e0018400 00009002 08100041 80a20480 00040104 0a022000 02000002 02402000 00006201 80002000 18258e10 21004000 89500118 00140000 80000000 88000000 9000042c 04000404 20060803 a0080000 80010660 | 10010002 81800008 60100902 1a090e30 24028040 08106014 0100e000 02301801 10100900 e00828d0 09390004 5001d000 04008827 08301002 008204a1 000c010c 08048080 02804000 01400000 00a22201 80100100 1c048e00 21814840 80500118 01942402 c0100081 88048400 90000885 0010010c 00468803 e0041000 800046e0 |