On Target MTOR_HUMAN 0.41904762/CHEMBL2152252
For the given ligand Glipizide, we have found in our database that, being scored 0.41904762, the most similar ligand is CHEMBL2152252. Check out the elaboration below.
| Glipizide (Given Ligand) | CHEMBL2152252 (Similar Ligand) |
|---|---|
| Cc3cnc(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)NC1CCCCC1)cc2)cn3 | CNC(=O)c1nc(cnc1N)c2ccc(Cl)c(c2)S(=O)(=O)Nc3cccc(F)c3F |
|
|
|
|
|
|
| 10000012 01801000 01100900 12b10e10 04000048 00100000 0800c000 00003005 10000080 000828d0 09292000 e0018400 00009002 08100041 80a20480 00040104 0a022000 02000002 02402000 00006201 80002000 18258e10 21004000 89500118 00140000 80000000 88000000 9000042c 04000404 20060803 a0080000 80010660 | 10018012 00800000 01100982 12b10e30 00000140 0451001a 1040c000 00081041 10000100 10024840 01292004 60008820 02048406 00101001 80aa00c0 80060104 08023400 12002020 04400000 00606200 c0000003 28008f00 21046840 08400008 00142081 80090000 08040e10 8000104d 0000440e 21669803 c1000800 c30302e0 |