On Target OPRX_HUMAN 0.083333336/CHEMBL26909
For the given ligand Metformin, we have found in our database that, being scored 0.083333336, the most similar ligand is CHEMBL26909. Check out the elaboration below.
| Metformin (Given Ligand) | CHEMBL26909 (Similar Ligand) |
|---|---|
| CN(C)C(=N)NC(=N)N | CC(C)CCC(C)N1CCC(CC1)N2[C@@H]3CCCC[C@H]3NC2=O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 00000000 00000000 00000000 00002000 00000000 00000002 00200000 00000002 00000000 00000000 00000000 00200000 00000000 00000000 00000000 00000000 00000100 00020000 00000000 00000000 00000000 00000000 40000000 20000000 00000010 00040000 00000001 00000000 | 00000000 01003400 00100000 04000c00 00000000 00000000 00000004 20002008 00000000 000001a0 00200000 50010000 00009002 00002000 00000000 00000000 00000000 00002000 02002040 00000201 00000100 300d0410 00000001 02100018 00010000 00000000 00000000 10000000 08000000 00040011 00180000 00002200 |