On Target OPRX_HUMAN 0.36051503/CHEMBL2088060
For the given ligand Canagliflozin, we have found in our database that, being scored 0.36051503, the most similar ligand is CHEMBL2088060. Check out the elaboration below.
| Canagliflozin (Given Ligand) | CHEMBL2088060 (Similar Ligand) |
|---|---|
| Cc2ccc([C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)cc2Cc4ccc(c3ccc(F)cc3)s4 | CN(C)C(=O)[C@H](CN1CCC2(CC1)OCCc3cc(F)sc23)Cc4ccccc4F.OC(C(O)C(=O)O)C(=O)O |
|
|
|
|
|
|
| 00012000 01800000 80100102 02050300 80a80051 10024010 00040480 0d102009 00000900 01480841 28100200 c0008a80 00000010 02a11000 00042000 020a9008 08020800 0200400a 15502000 50100005 00000920 680900a0 35004040 08400010 02000400 a4002000 00080800 40800265 020043ca 00068002 40020004 02c30600 | 00050040 05000600 00100d00 a6010600 00300250 00504012 00000580 20100041 00000900 204829e0 08300200 d001d880 1c00801a 00291001 00003000 060c0008 09200200 1200c2ca 05c0001a 00904215 00012924 58880e80 051040c0 00500010 02005c01 86002205 80090000 90040207 00400203 0006881b 48021000 40c12e10 |