On Target OPRX_HUMAN 0.36633664/CHEMBL241087
For the given ligand Sitagliptin, we have found in our database that, being scored 0.36633664, the most similar ligand is CHEMBL241087. Check out the elaboration below.
| Sitagliptin (Given Ligand) | CHEMBL241087 (Similar Ligand) |
|---|---|
| N[C@@H](CC(=O)N1CCn2c(C1)nnc2C(F)(F)F)Cc3cc(F)c(F)cc3F | CC1(C)CCC(N2CCC3(CC2)N(CNC3=O)c4ccccc4)c5ccc(F)cc15 |
|
|
|
|
|
|
| 00010040 01002408 40102102 02010e00 01100600 00100016 08800800 28002401 00100900 001929e0 08310120 d4019800 0c009006 04201000 00020800 0008200c 0100d200 020000a2 00400000 00b61a01 00000103 38232600 21000001 83500418 00010010 c0000400 c0400000 90021001 0c344004 00068013 84200080 00400e00 | 0002400e 01000400 00100122 12010e00 20000000 00000012 00000004 22003001 00300800 00082be0 08300004 5003b000 04009882 00203000 00020440 00000000 00040200 02402180 08002000 00100a01 60120100 38018600 20024000 00500012 00110000 c0000081 80004000 90000081 08108102 00868013 201c5000 00806600 |