On Target FYN_HUMAN 0.35664335/CHEMBL588119
For the given ligand Glimepiride, we have found in our database that, being scored 0.35664335, the most similar ligand is CHEMBL588119. Check out the elaboration below.
| Glimepiride (Given Ligand) | CHEMBL588119 (Similar Ligand) |
|---|---|
| CC/C3=C(C)/CN(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)N[C@@H]1CC[C@@H](C)CC1)cc2)C3=O | CCCCCCCCN[C@H](C)[C@@H](O)c1ccc(SC(C)C)cc1 |
|
|
|
|
|
|
| 00000010 01809000 01100100 02b10e00 00000048 08000000 08000004 20003404 01000000 011828c0 08202000 e0019400 04009102 00010041 80200000 00000000 22002008 02000500 02412040 00006201 80022100 18250710 00008000 89500018 00010000 88000000 80400000 1000052c 04000400 20060003 0c0a0000 00012660 | 00000000 01801200 00120100 00110600 00000080 00004000 00000000 20000000 00000980 000848c0 08700000 60018000 00000002 00050000 00080000 00080008 14000000 02000000 00002000 00000201 80000100 18340030 03800000 81500019 00000000 80000000 00000000 10000000 04000000 00060002 50020000 00012620 |