On Target FYN_HUMAN 0.29166666/CHEMBL305660
For the given ligand Canagliflozin, we have found in our database that, being scored 0.29166666, the most similar ligand is CHEMBL305660. Check out the elaboration below.
| Canagliflozin (Given Ligand) | CHEMBL305660 (Similar Ligand) |
|---|---|
| Cc2ccc([C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)cc2Cc4ccc(c3ccc(F)cc3)s4 | CC(C)(C)c1ccc(cc1)C(=O)CCCN2CCC(CC2)OC(c3ccccc3)c4ccccc4 |
|
|
|
|
|
|
| 00012000 01800000 80100102 02050300 80a80051 10024010 00040480 0d102009 00000900 01480841 28100200 c0008a80 00000010 02a11000 00042000 020a9008 08020800 0200400a 15502000 50100005 00000920 680900a0 35004040 08400010 02000400 a4002000 00080800 40800265 020043ca 00068002 40020004 02c30600 | 00020000 01000800 00100102 40010600 00000010 00004000 00000000 21000000 00100900 000808c0 08300000 50019800 04008002 00290000 00000000 02080008 00200000 02000000 00800000 00000201 00000120 18020220 01000080 00500014 00000401 a0002000 00080000 50000000 00000280 00060002 c0000000 02802600 |