On Target ESR1_HUMAN 0.39037433/CHEMBL3764690
For the given ligand Canagliflozin, we have found in our database that, being scored 0.39037433, the most similar ligand is CHEMBL3764690. Check out the elaboration below.
| Canagliflozin (Given Ligand) | CHEMBL3764690 (Similar Ligand) |
|---|---|
| Cc2ccc([C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)cc2Cc4ccc(c3ccc(F)cc3)s4 | Cc1ccc(cc1)C(=O)c2sc3cc(O)ccc3c2c4ccc(F)cc4 |
|
|
|
|
|
|
| 00012000 01800000 80100102 02050300 80a80051 10024010 00040480 0d102009 00000900 01480841 28100200 c0008a80 00000010 02a11000 00042000 020a9008 08020800 0200400a 15502000 50100005 00000920 680900a0 35004040 08400010 02000400 a4002000 00080800 40800265 020043ca 00068002 40020004 02c30600 | 08012040 11000809 20100900 42010200 00980000 00808010 42000480 01002081 00400100 00c80840 08100200 c0018880 0000803a 02201001 20003181 00000008 01030800 0200000a 0c100000 00120204 00000800 480e0288 10004090 10400014 02800002 a4100000 00010000 40000445 02004180 00028002 80000000 00c10600 |