On Target 5HT2C_HUMAN 0.4452555/CHEMBL1933402
For the given ligand Glimepiride, we have found in our database that, being scored 0.4452555, the most similar ligand is CHEMBL1933402. Check out the elaboration below.
| Glimepiride (Given Ligand) | CHEMBL1933402 (Similar Ligand) |
|---|---|
| CC/C3=C(C)/CN(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)N[C@@H]1CC[C@@H](C)CC1)cc2)C3=O | CCCc1ccc(cc1)S(=O)(=O)N(C)C2CCN(C)CC2 |
|
|
|
|
|
|
| 00000010 01809000 01100100 02b10e00 00000048 08000000 08000004 20003404 01000000 011828c0 08202000 e0019400 04009102 00010041 80200000 00000000 22002008 02000500 02412040 00006201 80022100 18250710 00008000 89500018 00010000 88000000 80400000 1000052c 04000400 20060003 0c0a0000 00012660 | 00000010 01801400 01100100 01b10600 00080008 00000000 00000000 00000000 00000800 004809e0 08302000 70018000 00000002 00000001 80a00000 00000000 00002000 02000000 00400000 00007603 80000100 18040000 00000000 18500018 02000000 8000000c 00000000 1000002c 00000400 20060012 00000000 00010660 |