On Target PTGES_HUMAN 0.3382353/CHEMBL3665478
For the given ligand Sitagliptin, we have found in our database that, being scored 0.3382353, the most similar ligand is CHEMBL3665478. Check out the elaboration below.
| Sitagliptin (Given Ligand) | CHEMBL3665478 (Similar Ligand) |
|---|---|
| N[C@@H](CC(=O)N1CCn2c(C1)nnc2C(F)(F)F)Cc3cc(F)c(F)cc3F | Cn1c(Nc2c(Cl)ccc(CNC(=O)C(C)(C)C)c2Cl)nc3cc(C(=O)N[C@@H]4CC[C@H](CC4)C(F)(F)F)c(cc13)N5CCn6ncnc6C5 |
|
|
|
|
|
|
| 00010040 01002408 40102102 02010e00 01100600 00100016 08800800 28002401 00100900 001929e0 08310120 d4019800 0c009006 04201000 00020800 0008200c 0100d200 020000a2 00400000 00b61a01 00000103 38232600 21000001 83500418 00010010 c0000400 c0400000 90021001 0c344004 00068013 84200080 00400e00 | 1000c006 01a09808 40100120 000d0e00 01160c4c 0811c064 00808000 2a003405 00800900 20100ad2 0921902c 44019800 02009846 00400400 00020c60 001c204c 0024c008 1340400e 0ae02000 10a00205 e0100801 7c2787f0 21800885 0270001c 00456001 c0000601 040400e0 90031180 0844811c 02461851 ec068080 40020be0 |