On Target MIF_HUMAN 0.27407408/CHEMBL3409229
For the given ligand Glimepiride, we have found in our database that, being scored 0.27407408, the most similar ligand is CHEMBL3409229. Check out the elaboration below.
| Glimepiride (Given Ligand) | CHEMBL3409229 (Similar Ligand) |
|---|---|
| CC/C3=C(C)/CN(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)N[C@@H]1CC[C@@H](C)CC1)cc2)C3=O | NS(=O)(=O)c1ccc(CN=C=S)cc1 |
|
|
|
|
|
|
| 00000010 01809000 01100100 02b10e00 00000048 08000000 08000004 20003404 01000000 011828c0 08202000 e0019400 04009102 00010041 80200000 00000000 22002008 02000500 02412040 00006201 80022100 18250710 00008000 89500018 00010000 88000000 80400000 1000052c 04000400 20060003 0c0a0000 00012660 | 00000010 00801000 01000100 00b10620 00000008 00000000 00000000 00001000 00000000 00000840 00002000 60008000 00000800 00080001 80200000 00000000 00200800 02000200 00000000 00002000 80000002 28088000 00000000 08400808 00200000 80100000 40000000 00000028 00000000 20060000 00040000 00010028 |