On Target HRH1_HUMAN 0.51898736/CHEMBL2171013
For the given ligand Glimepiride, we have found in our database that, being scored 0.51898736, the most similar ligand is CHEMBL2171013. Check out the elaboration below.
| Glimepiride (Given Ligand) | CHEMBL2171013 (Similar Ligand) |
|---|---|
| CC/C3=C(C)/CN(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)N[C@@H]1CC[C@@H](C)CC1)cc2)C3=O | CN(C(=O)N1CCC(CC1)N2CCC(CC2)Oc3ccc(Cl)c(Cl)c3)S(=O)(=O)c4ccc(C)cc4 |
|
|
|
|
|
|
| 00000010 01809000 01100100 02b10e00 00000048 08000000 08000004 20003404 01000000 011828c0 08202000 e0019400 04009102 00010041 80200000 00000000 22002008 02000500 02412040 00006201 80022100 18250710 00008000 89500018 00010000 88000000 80400000 1000052c 04000400 20060003 0c0a0000 00012660 | 04008010 01801408 21100108 02b10e00 00001008 02000000 9a000004 20003000 00000000 000029e0 00202000 f0018c00 02809006 00000043 81200003 00082008 02202000 02000400 00c00000 00026201 80002100 180d0500 01000080 08500018 00012001 80100000 80100000 1000042c 00000600 20060011 00180000 00032260 |