On Target NMDE1_HUMAN 0.28654972/CHEMBL2333945
For the given ligand Glimepiride, we have found in our database that, being scored 0.28654972, the most similar ligand is CHEMBL2333945. Check out the elaboration below.
| Glimepiride (Given Ligand) | CHEMBL2333945 (Similar Ligand) |
|---|---|
| CC/C3=C(C)/CN(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)N[C@@H]1CC[C@@H](C)CC1)cc2)C3=O | Fc1ccc(cc1Cl)S(=O)(=O)NCc2ccc(cc2)C(=O)NNC(=O)c3ccccc3 |
|
|
|
|
|
|
| 00000010 01809000 01100100 02b10e00 00000048 08000000 08000004 20003404 01000000 011828c0 08202000 e0019400 04009102 00010041 80200000 00000000 22002008 02000500 02412040 00006201 80022100 18250710 00008000 89500018 00010000 88000000 80400000 1000052c 04000400 20060003 0c0a0000 00012660 | 00008014 08808800 01180100 43b10600 00080000 00000010 04000801 00001000 00000100 40001848 40102000 60008800 82008804 00201201 a0200000 00000004 00002000 02100000 04400000 00006000 80000000 08028702 40000000 0840000c 02002000 80101004 40000000 0000000d 00000400 204e8002 80040000 001703e0 |