On Target IKKB_HUMAN 0.07017544/CHEMBL474802
For the given ligand Metformin, we have found in our database that, being scored 0.07017544, the most similar ligand is CHEMBL474802. Check out the elaboration below.
| Metformin (Given Ligand) | CHEMBL474802 (Similar Ligand) |
|---|---|
| CN(C)C(=N)NC(=N)N | Clc1ccc(OCCCCCCN\C(=N/C#C)\Nc2ccncc2)cc1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 00000000 00000000 00000000 00002000 00000000 00000002 00200000 00000002 00000000 00000000 00000000 00200000 00000000 00000000 00000000 00000000 00000100 00020000 00000000 00000000 00000000 00000000 40000000 20000000 00000010 00040000 00000001 00000000 | 04008046 01000018 20104008 00010f00 104c1000 02000000 02008004 01002001 00000200 000008c2 10200004 40018804 02801806 00800108 11000001 001c200c 00840800 00400400 00602000 00020801 40022100 18058110 21820000 00100030 00112000 00000000 40108000 10000080 000002b0 00060000 80080000 00020260 |