On Target MK03_HUMAN 0.28346458/CHEMBL213618
For the given ligand Canagliflozin, we have found in our database that, being scored 0.28346458, the most similar ligand is CHEMBL213618. Check out the elaboration below.
| Canagliflozin (Given Ligand) | CHEMBL213618 (Similar Ligand) |
|---|---|
| Cc2ccc([C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)cc2Cc4ccc(c3ccc(F)cc3)s4 | CNc1nccc(n1)c2ccc(s2)C(=O)N[C@H](CN)Cc3ccc(Cl)cc3Cl |
|
|
|
|
|
|
| 00012000 01800000 80100102 02050300 80a80051 10024010 00040480 0d102009 00000900 01480841 28100200 c0008a80 00000010 02a11000 00042000 020a9008 08020800 0200400a 15502000 50100005 00000920 680900a0 35004040 08400010 02000400 a4002000 00080800 40800265 020043ca 00068002 40020004 02c30600 | 0001a042 00003a10 82110101 40050600 01000204 00024020 000c2080 1e0e500e 00800d80 000908c1 08328204 60008b80 82008836 00100420 00022400 000c0205 03071000 0200600c 04610000 10a00209 00001500 7d22a780 34802840 9b40011c 02002100 c4000200 01040000 80002264 0c18031c 0046080b e0000800 00c306a1 |