On Target MK03_HUMAN 0.28421053/CHEMBL3113587
For the given ligand Sitagliptin, we have found in our database that, being scored 0.28421053, the most similar ligand is CHEMBL3113587. Check out the elaboration below.
| Sitagliptin (Given Ligand) | CHEMBL3113587 (Similar Ligand) |
|---|---|
| N[C@@H](CC(=O)N1CCn2c(C1)nnc2C(F)(F)F)Cc3cc(F)c(F)cc3F | CCCCCCCCCC(NC(=O)CNC(=O)OCc1ccccc1)C(=O)NCCc2ccccc2 |
|
|
|
|
|
|
| 00010040 01002408 40102102 02010e00 01100600 00100016 08800800 28002401 00100900 001929e0 08310120 d4019800 0c009006 04201000 00020800 0008200c 0100d200 020000a2 00400000 00b61a01 00000103 38232600 21000001 83500418 00010010 c0000400 c0400000 90021001 0c344004 00068013 84200080 00400e00 | 01010000 01403000 00100100 04010600 00000000 00014000 00000000 2000000c 00800380 000808c0 08200000 4001b000 0e00800a 00012001 00000000 021a0008 00020000 02000400 00002890 00000201 00000000 38240e30 00000003 83500018 00000000 80002002 00000000 10200020 0c000200 00060003 e0024000 00002600 |