On Target NMDZ1_HUMAN 0.23970038/CHEMBL354003
For the given ligand Laninamivir, we have found in our database that, being scored 0.23970038, the most similar ligand is CHEMBL354003. Check out the elaboration below.
| Laninamivir (Given Ligand) | CHEMBL354003 (Similar Ligand) |
|---|---|
| CO[C@H]([C@H](O)CO)[C@@H]1O/C(C(=O)O)=C\[C@H](NC(=N)N)[C@H]1NC(C)=O | OC(=O)c1[nH]c2cc(Cl)cc(Cl)c2c1CN3CC(=O)N(C4CCCCC4)C3=O |
|
|
|
|
|
|
| 00000000 8904f200 00100101 84010d01 003c00c1 00200200 00080180 38802c48 01002600 011000ca 80200000 4001c000 8002b002 01892000 02001408 391b9008 30a10814 80000540 51c16010 00002201 20000020 70152fb0 17008080 0a10001c 00021403 88008c00 40c04200 90000121 0800c250 00040401 ac0e0000 00004a00 | 10018002 09803800 00100100 14010e10 000c1020 0000c020 04004084 2a003008 00000300 000908c8 01280004 4001a800 0600988e 0070a400 800204c0 020c000c 0006c008 0280200c 02202040 00000201 c0020100 38078ff8 20802003 8250011c 00056000 c0000400 08044000 90000000 08000104 00060001 e00cc200 80420220 |