On Target PERM_HUMAN 0.325/CHEMBL3739930
For the given ligand Baloxavir, we have found in our database that, being scored 0.325, the most similar ligand is CHEMBL3739930. Check out the elaboration below.
| Baloxavir (Given Ligand) | CHEMBL3739930 (Similar Ligand) |
|---|---|
| COC(=O)OCOc6c5C(=O)N1CCOC[C@H]1N([C@@H]4c2ccccc2SCc3c(F)c(F)ccc34)n5ccc6=O | COc1cc2NC(=S)N(NC(=O)c3cccc(F)c3)C(=O)c2cc1OC |
|
|
|
|
|
|
| 008002be 0380ce08 671a6508 93310e00 041e11a8 00720136 184c0404 03247603 02304001 007b68c0 4b690414 708580b8 58009d06 48741008 01021478 022c610d 34025208 0200459a 00380060 001a0203 c0060501 0843ae00 72806000 4250811d 24102410 f0000081 84904860 e0040001 0b083384 04cfc013 94040001 c0c547a8 | 0008000e 00000c08 20100108 02010600 02141080 00004030 0e090000 00003a08 06284120 400d2860 05000004 50008000 4000cc06 00601000 01000041 000c800c 10000010 03408008 00600020 00870000 40080100 08038628 62812050 02500204 00102000 e0200001 20010000 00040041 08006280 004f801a c0040020 80210e88 |