On Target ACES_HUMAN 0.41758242/CHEMBL1783535
For the given ligand Peramivir, we have found in our database that, being scored 0.41758242, the most similar ligand is CHEMBL1783535. Check out the elaboration below.
| Peramivir (Given Ligand) | CHEMBL1783535 (Similar Ligand) |
|---|---|
| CCC(CC)[C@H](NC(C)=O)[C@H]1[C@H](NC(=N)N)C[C@H](C(=O)O)[C@H]1O | CC(C)C1=N[C@H]2CC[C@]34C[C@@]35[C@@H](CC[C@H]4[C@]2(C)CC1)[C@]6(C)C[C@@H](O)[C@H]([C@H](C)N(C)C)[C@@]6(C)CC5=O |
|
|
|
|
|
|
| 00030000 01001400 00100000 00000c00 00180000 00000000 00000000 20002000 00000200 000001a2 00200000 40011000 1400901a 01800000 00000000 00180008 00000000 00000000 01c02000 00000201 00000000 101d2e10 01000080 00100018 00000003 00000000 40000000 10000000 00000010 01040011 801a0000 00800a00 | 00010002 01000000 00300000 04000c00 00080000 00000000 10000000 00002000 00000000 20000081 00210100 40011000 04008038 01802000 00000000 00080008 00000800 00000000 02c02000 00020001 00000001 30010210 01000081 02100810 00000000 00020000 40000000 10001000 08000000 01040000 00020000 00000200 |