On Target TRPV1_RAT 0.30722892/CHEMBL3326588
For the given ligand Baloxavir, we have found in our database that, being scored 0.30722892, the most similar ligand is CHEMBL3326588. Check out the elaboration below.
| Baloxavir (Given Ligand) | CHEMBL3326588 (Similar Ligand) |
|---|---|
| COC(=O)OCOc6c5C(=O)N1CCOC[C@H]1N([C@@H]4c2ccccc2SCc3c(F)c(F)ccc34)n5ccc6=O | Cc1cc2c(NC(=O)N[C@@H]3CC(CF)(CF)Oc4cc(Cl)ccc34)cccc2cn1 |
|
|
|
|
|
|
| 008002be 0380ce08 671a6508 93310e00 041e11a8 00720136 184c0404 03247603 02304001 007b68c0 4b690414 708580b8 58009d06 48741008 01021478 022c610d 34025208 0200459a 00380060 001a0203 c0060501 0843ae00 72806000 4250811d 24102410 f0000081 84904860 e0040001 0b083384 04cfc013 94040001 c0c547a8 | 04808006 01801818 2010410a 10010f00 00041020 82000100 92000004 03003601 00000800 002808c0 09380004 40008840 02809866 00708002 11020243 020c200c 00244000 02408008 08e00400 00020005 c0000140 18158508 218220c0 e0500018 00112002 c0000000 00040160 90000080 00008304 06064003 040c0000 80024640 |