On Target FABP5_HUMAN 0.22829582/CHEMBL3943278
For the given ligand Laninamivir, we have found in our database that, being scored 0.22829582, the most similar ligand is CHEMBL3943278. Check out the elaboration below.
| Laninamivir (Given Ligand) | CHEMBL3943278 (Similar Ligand) |
|---|---|
| CO[C@H]([C@H](O)CO)[C@@H]1O/C(C(=O)O)=C\[C@H](NC(=N)N)[C@H]1NC(C)=O | Cc1nsc(n1)c2c(C)c(C)sc2NC(=O)C3=C(C4CCC3CC4)C(=O)O |
|
|
|
|
|
|
| 00000000 8904f200 00100101 84010d01 003c00c1 00200200 00080180 38802c48 01002600 011000ca 80200000 4001c000 8002b002 01892000 02001408 391b9008 30a10814 80000540 51c16010 00002201 20000020 70152fb0 17008080 0a10001c 00021403 88008c00 40c04200 90000121 0800c250 00040401 ac0e0000 00004a00 | 0043c212 01028800 40100900 00001e02 64381002 00082540 c1088180 18a02772 01001101 00100093 04298304 e0011ce8 0f828118 00b18001 80123401 0038010e 61040000 12002138 3a632018 01000001 00100008 5b000f90 6110a001 00534010 12245080 0c218e02 00c14010 90001484 00010114 222e0001 24020800 00e10201 |