On Target FABP5_HUMAN 0.25/CHEMBL394440
For the given ligand Baloxavir, we have found in our database that, being scored 0.25, the most similar ligand is CHEMBL394440. Check out the elaboration below.
| Baloxavir (Given Ligand) | CHEMBL394440 (Similar Ligand) |
|---|---|
| COC(=O)OCOc6c5C(=O)N1CCOC[C@H]1N([C@@H]4c2ccccc2SCc3c(F)c(F)ccc34)n5ccc6=O | CCc1c(c2ccccc2)c(nn1c3ccccc3c4cccc(c4)C(=O)O)c5ccccc5 |
|
|
|
|
|
|
| 008002be 0380ce08 671a6508 93310e00 041e11a8 00720136 184c0404 03247603 02304001 007b68c0 4b690414 708580b8 58009d06 48741008 01021478 022c610d 34025208 0200459a 00380060 001a0203 c0060501 0843ae00 72806000 4250811d 24102410 f0000081 84904860 e0040001 0b083384 04cfc013 94040001 c0c547a8 | 0000a006 40000a09 a0000180 10010610 21080021 0010600a 00440000 00081200 00000104 100d88c0 01008084 60008800 02008810 00300200 20020840 8a0c204c 00020240 82c03000 04480100 40621040 40020048 1843aa24 30806800 8340451c 00802001 c10800c0 14120000 00000861 14014184 1046040b c0060a00 800004a2 |