On Target PAR1_HUMAN 0.5714286/CHEMBL80672
For the given ligand Peramivir, we have found in our database that, being scored 0.5714286, the most similar ligand is CHEMBL80672. Check out the elaboration below.
| Peramivir (Given Ligand) | CHEMBL80672 (Similar Ligand) |
|---|---|
| CCC(CC)[C@H](NC(C)=O)[C@H]1[C@H](NC(=N)N)C[C@H](C(=O)O)[C@H]1O | OC(=O)CCNC(=O)[C@@H]1CCCN(C1)C(=O)CCC2CCNCC2 |
|
|
|
|
|
|
| 00030000 01001400 00100000 00000c00 00180000 00000000 00000000 20002000 00000200 000001a2 00200000 40011000 1400901a 01800000 00000000 00180008 00000000 00000000 01c02000 00000201 00000000 101d2e10 01000080 00100018 00000003 00000000 40000000 10000000 00000010 01040011 801a0000 00800a00 | 00010000 01001400 00100000 00000400 00000000 00000000 00000000 20000000 00000000 000001a0 00200000 50011000 0c00801a 00000000 00000000 00080008 00000000 00000001 00802010 00000201 00000000 101c0e30 01000080 00100018 00001001 00000000 00000000 10000000 00000000 00040011 00000000 00002200 |