On Target SC6A4_HUMAN 0.32765958/CHEMBL421546
For the given ligand Laninamivir, we have found in our database that, being scored 0.32765958, the most similar ligand is CHEMBL421546. Check out the elaboration below.
| Laninamivir (Given Ligand) | CHEMBL421546 (Similar Ligand) |
|---|---|
| CO[C@H]([C@H](O)CO)[C@@H]1O/C(C(=O)O)=C\[C@H](NC(=N)N)[C@H]1NC(C)=O | COC(=O)C1=C(CC2C[C@@H](O)C1N2C)c3ccc4ccccc4c3 |
|
|
|
|
|
|
| 00000000 8904f200 00100101 84010d01 003c00c1 00200200 00080180 38802c48 01002600 011000ca 80200000 4001c000 8002b002 01892000 02001408 391b9008 30a10814 80000540 51c16010 00002201 20000020 70152fb0 17008080 0a10001c 00021403 88008c00 40c04200 90000121 0800c250 00040401 ac0e0000 00004a00 | 00050010 09008200 00100b02 00010700 00280080 00000810 80180180 38000402 01800800 005808c8 48300200 41019000 0c02810a 00a10000 00080406 000c0108 30a20400 02000140 10c1a01a 00800201 00000100 58000a98 030080a0 00500010 01201081 80000400 00486000 d0010400 00400202 0006040a 24020000 02002610 |